Vinylogous acids
Medchemexpress LLC HY-18407 100mg Medchemexpress, N-Methylisatoic anhydride CAS:10328-92-4 Purity:>98%
Medchemexpress, HY-P7198 10ug I-309/CCL1 (CHO-expressed), Human CAS: Recombinant Human I-309/CCL1 (CHO-expressed) attracts monocytes, NK cells, and immature B cells and dendritic cells by interacting with a cell surface chemokine receptor called CCR8. Purity:>98% Medchemexpress has over 10000 novel life-science reagents, reference compounds, APIs and natural compounds for laboratory and scientific use. Other quantity can also be offered.
Matrix Scientific 1-METHYL-1H-PYRAZOLE-4-CARB-1G
1-Methyl-1H-pyrazole-4-carboxylic acid, 97%; 1g,C5H6N2O2, MFCD00159641, mw 126.12, [5952-92-1]
eMolecules 59551-75-6 | 3-(2-Methoxyethoxy)propyl bromide | Combi-Blocks | MFCD01321130 | 197.072 | C6H13BrO2 | 98.000 | COCCOCCCBr | 1g | 267202774
3-(2-Methoxyethoxy)propyl bromide | Combi-Blocks | 59551-75-6 | MFCD01321130 | 197.072 | C6H13BrO2 | 98.000 | COCCOCCCBr | 1g | 267202774
![eMolecules 667436-13-7 | 5-PROPYL-4,5,6,7-TETRAHYDROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID | AstaTech | MFCD03900514 | 224.320 | C12H16O2S | 98.000 | CCCC1CCc2sc(cc2C1)C(O)=O | 0.25g | 696740255](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502457558.PNG-250.jpg)
eMolecules 667436-13-7 | 5-PROPYL-4,5,6,7-TETRAHYDROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID | AstaTech | MFCD03900514 | 224.320 | C12H16O2S | 98.000 | CCCC1CCc2sc(cc2C1)C(O)=O | 0.25g | 696740255
5-PROPYL-4,5,6,7-TETRAHYDROBENZO[B]THIOPHENE-2-CARBOXYLIC ACID | AstaTech | 667436-13-7 | MFCD03900514 | 224.320 | C12H16O2S | 98.000 | CCCC1CCc2sc(cc2C1)C(O)=O | 0.25g | 696740255
![eMolecules 34954-65-9 | 3-METHOXY-ISATOIC ANHYDRIDE | AstaTech | MFCD04114326 | 193.158 | C9H7NO4 | 97.000 | COc1cccc2c1[nH]c(=O)oc2=O | 1g | 112528003](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502171081.JPG-250.jpg)
eMolecules 34954-65-9 | 3-METHOXY-ISATOIC ANHYDRIDE | AstaTech | MFCD04114326 | 193.158 | C9H7NO4 | 97.000 | COc1cccc2c1[nH]c(=O)oc2=O | 1g | 112528003
3-METHOXY-ISATOIC ANHYDRIDE | AstaTech | 34954-65-9 | MFCD04114326 | 193.158 | C9H7NO4 | 97.000 | COc1cccc2c1[nH]c(=O)oc2=O | 1g | 112528003
eMolecules 1352305-22-6 | 2-(4-Methoxy-phenoxy)-propylamine hydrochloride | Combi-Blocks | MFCD03002050 | 217.690 | C10H16ClNO2 | 96.000 | Cl.COc1ccc(OC(C)CN)cc1 | 1g | 267205878
2-(4-Methoxy-phenoxy)-propylamine hydrochloride | Combi-Blocks | 1352305-22-6 | MFCD03002050 | 217.690 | C10H16ClNO2 | 96.000 | Cl.COc1ccc(OC(C)CN)cc1 | 1g | 267205878
Sigma Aldrich Fine Chemicals Biosciences Ethyl indole-3-carboxylate European Pharmacopoeia (EP) Reference Standard | 776-41-0 | MFCD00228454 |
Ethyl indole-3-carboxylate European Pharmacopoeia (EP) Reference Standard | Mol Wt: 189.21 | 776-41-0 | MFCD00228454 |
![eMolecules 387-18-8 | 6-(Trifluoromethyl)isatoic anhydride | Apollo Scientific | MFCD24850066 | 231.130 | C9H4F3NO3 | 97.000 | FC(F)(F)c1cccc2[nH]c(=O)oc(=O)c12 | 1g | 562428649](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502153675.JPG-250.jpg)
eMolecules 387-18-8 | 6-(Trifluoromethyl)isatoic anhydride | Apollo Scientific | MFCD24850066 | 231.130 | C9H4F3NO3 | 97.000 | FC(F)(F)c1cccc2[nH]c(=O)oc(=O)c12 | 1g | 562428649
6-(Trifluoromethyl)isatoic anhydride | Apollo Scientific | 387-18-8 | MFCD24850066 | 231.130 | C9H4F3NO3 | 97.000 | FC(F)(F)c1cccc2[nH]c(=O)oc(=O)c12 | 1g | 562428649
eMolecules 1315591-34-4 | (3R)-3-(2-METHOXYETHOXY)PYRROLIDINE HCL | MFCD29037433 | 1g
Medchem Express | Cav 2.2 blocker 1 | 5mg | 482204197 | HY-119373 | 1567335-29-8 | 424.970 | C25H29ClN2O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 57021-58-6 | Ambeed | 4567-Tetrahydrobenzo[b]thiophene-2-carboxamide | 100mg | 525241965 | A846499 | MFCD00460789 | 181.25 | C9H11NOS](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502485727.JPG-250.jpg)
eMolecules 57021-58-6 | Ambeed | 4567-Tetrahydrobenzo[b]thiophene-2-carboxamide | 100mg | 525241965 | A846499 | MFCD00460789 | 181.25 | C9H11NOS
Ambeed | 4567-Tetrahydrobenzo[b]thiophene-2-carboxamide | 100mg | 525241965 | A846499 | 57021-58-6 | MFCD00460789 | 181.250 | C9H11NOS
Accela Chembio Inc 3 | 5-dimethylpyrazole-4-carboxylic Acid | 1g | 113808-86-9 | MFCD00159642 | 97+% | Shelf Life: 1260 Days | Light Sensitive
3 | 5-dimethylpyrazole-4-carboxylic Acid | 1g | 113808-86-9 | MFCD00159642 | 97+% | Shelf Life: 1260 Days | Light Sensitive
Sigma Aldrich Fine Chemicals Biosciences 4-Aminoantipyrine reagent grade | 83-07-8 | MFCD00003145 | 50G
4-Aminoantipyrine reagent grade | Purity: >=97% (HPLC) | Mol Wt: 203.24 | 83-07-8 | MFCD00003145 | 50G
Chem-Impex International, Inc. Indole-7-carboxylic acid | 1670-83-3 | MFCD00210442 | 5G
Indole-7-carboxylic acid, 1670-83-3, MFCD00210442, 5G